Difference between revisions of "PWY-5437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-2 CPD1F-2] == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-2 CPD1F-2] ==
 
* common-name:
 
* common-name:
** methylacrylyl-coa
+
** (-)-methyl jasmonate
 
* smiles:
 
* smiles:
** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 
* inchi-key:
 
* inchi-key:
** npalueycdzwbov-ndzskpawsa-j
+
** gewdntwnsazudx-wqmvxfaesa-n
 
* molecular-weight:
 
* molecular-weight:
** 831.577
+
** 224.299
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[RXN-10767]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MCDH]]
 
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylacrylyl-coa}}
+
{{#set: common-name=(-)-methyl jasmonate}}
{{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}}
+
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
{{#set: molecular-weight=831.577}}
+
{{#set: molecular-weight=224.299}}

Revision as of 09:22, 27 August 2019

Metabolite CPD1F-2

  • common-name:
    • (-)-methyl jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(oc)=o)
  • inchi-key:
    • gewdntwnsazudx-wqmvxfaesa-n
  • molecular-weight:
    • 224.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality