Difference between revisions of "PWY-5451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(o...")
 
(Created page with "Category:pathway == Pathway PWY-5451 == * taxonomic-range: ** tax-40674 * common-name: ** acetone degradation i (to methylglyoxal) == Reaction(s) found == * RXN-17625...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] ==
+
== Pathway PWY-5451 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** maltopentaose
+
** acetone degradation i (to methylglyoxal)
* smiles:
+
== Reaction(s) found ==
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
+
* [[RXN-17625]]
* inchi-key:
+
* [[RXN-8630]]
** ftnipwxxignqqf-hzwihctqsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-17626 RXN-17626]
** 828.725
+
* [NoneACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN]
* [[RXN-14281]]
+
{{#set: taxonomic-range=tax-40674}}
* [[RXN-14284]]
+
{{#set: common-name=acetone degradation i (to methylglyoxal)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-14282]]
+
{{#set: completion rate=0.4}}
* [[RXN-14285]]
+
{{#set: nb total reaction=5}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=maltopentaose}}
 
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
 
{{#set: molecular-weight=828.725}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5451

  • taxonomic-range:
    • tax-40674
  • common-name:
    • acetone degradation i (to methylglyoxal)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17626 RXN-17626]
  • [NoneACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN]
  • [NoneISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN]