Difference between revisions of "PWY-5451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENIN GLYCOGENIN] == * common-name: ** a [glycogenin] == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENIN GLYCOGENIN] ==
 
* common-name:
 
* common-name:
** maltopentaose
+
** a [glycogenin]
* smiles:
 
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
* inchi-key:
 
** ftnipwxxignqqf-hzwihctqsa-n
 
* molecular-weight:
 
** 828.725
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14281]]
+
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
* [[RXN-14284]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14282]]
 
* [[RXN-14285]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltopentaose}}
+
{{#set: common-name=a [glycogenin]}}
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
 
{{#set: molecular-weight=828.725}}
 

Revision as of 14:19, 26 August 2019

Metabolite GLYCOGENIN

  • common-name:
    • a [glycogenin]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycogenin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.