Difference between revisions of "PWY-5466"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] ==
+== Pathway PWY-5466 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 5',5'''-diadenosine triphosphate
+** matairesinol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
+* [[RXN-17351]]
-* inchi-key:
+* [[RXN-17352]]
-** qcicupzzliqapa-xpwfqurosa-k
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-8680 RXN-8680]
-** 753.388
+* [NoneRXN-8679 RXN-8679]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8681 RXN-8681]
-* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
+* [NoneRXN-8683 RXN-8683]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8684 RXN-8684]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-8678 RXN-8678]
-{{#set: common-name=5',5'''-diadenosine triphosphate}}
+* [NoneRXN-17353 RXN-17353]
-{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
+* [NoneRXN-8677 RXN-8677]
-{{#set: molecular-weight=753.388}}
+{{#set: taxonomic-range=tax-33090}}
+{{#set: common-name=matairesinol biosynthesis}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.2}}
+{{#set: nb total reaction=10}}