Difference between revisions of "PWY-5466"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] ==
+== Pathway PWY-6446 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 5',5'''-diadenosine triphosphate
+** benzoate biosynthesis iii (coa-dependent, non-&beta;-oxidative)
-* smiles:
+== Reaction(s) found ==
-** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
+* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** qcicupzzliqapa-xpwfqurosa-k
+* [NoneRXN-11278 RXN-11278]
-* molecular-weight:
+* [NoneRXN-2002 RXN-2002]
-** 753.388
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=benzoate biosynthesis iii (coa-dependent, non-&beta;-oxidative)}}
-* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=5',5'''-diadenosine triphosphate}}
-{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
-{{#set: molecular-weight=753.388}}