Difference between revisions of "PWY-5469"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * common-name: ** 7,8-dihydropterin * smiles: ** c1(=nc2(=c(nc1)n=c(n)n...")
(Created page with "Category:pathway == Pathway PWY-5469 == * taxonomic-range: ** tax-33090 * common-name: ** sesamin biosynthesis == Reaction(s) found == * RXN-17351 * RXN-17352 == R...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
+
== Pathway PWY-5469 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** 7,8-dihydropterin
+
** sesamin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c1(=nc2(=c(nc1)n=c(n)nc(=o)2))
+
* [[RXN-17351]]
* inchi-key:
+
* [[RXN-17352]]
** pxzwkvixskscfr-uhfffaoysa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-8703 RXN-8703]
** 165.154
+
* [NoneRXN-8695 RXN-8695]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-8704 RXN-8704]
* [[RXN-15261]]
+
* [NoneRXN-8696 RXN-8696]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-8705 RXN-8705]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-8677 RXN-8677]
{{#set: common-name=7,8-dihydropterin}}
+
{{#set: taxonomic-range=tax-33090}}
{{#set: inchi-key=inchikey=pxzwkvixskscfr-uhfffaoysa-n}}
+
{{#set: common-name=sesamin biosynthesis}}
{{#set: molecular-weight=165.154}}
+
{{#set: nb reaction found=2}}
 +
{{#set: completion rate=0.25}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5469

  • taxonomic-range:
    • tax-33090
  • common-name:
    • sesamin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8703 RXN-8703]
  • [NoneRXN-8695 RXN-8695]
  • [NoneRXN-8704 RXN-8704]
  • [NoneRXN-8696 RXN-8696]
  • [NoneRXN-8705 RXN-8705]
  • [NoneRXN-8677 RXN-8677]