Difference between revisions of "PWY-5469"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * common-name: ** 4α-carboxy-5α-cholesta-8-en-3β-ol * sm...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == * common-name: ** coproporphyrinogen i * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] ==
 
* common-name:
 
* common-name:
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** coproporphyrinogen i
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c([o-])=o)c(o)cc3)))cc4)))c
+
** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
* inchi-key:
** rodbxvvnkjcwqr-gsqagghasa-m
+
** wiuggjkhyqignh-uhfffaoysa-j
 
* molecular-weight:
 
* molecular-weight:
** 429.662
+
** 656.734
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-23]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=coproporphyrinogen i}}
{{#set: inchi-key=inchikey=rodbxvvnkjcwqr-gsqagghasa-m}}
+
{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
{{#set: molecular-weight=429.662}}
+
{{#set: molecular-weight=656.734}}

Revision as of 14:19, 26 August 2019

Metabolite COPROPORPHYRINOGEN_I

  • common-name:
    • coproporphyrinogen i
  • smiles:
    • cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
  • inchi-key:
    • wiuggjkhyqignh-uhfffaoysa-j
  • molecular-weight:
    • 656.734

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality