Difference between revisions of "PWY-5483"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * common-name: ** n-carbamoyl-l-aspartate * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * common-name: ** 14-oxolanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** 14-oxolanosterol
 
* smiles:
 
* smiles:
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
+
** cc(c)=cccc([ch]1(c2(c)(c(c=o)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
 
* inchi-key:
 
* inchi-key:
** hlkxyzvtanabhz-reohclbhsa-l
+
** pggimliqohyfis-puxrvuthsa-n
 
* molecular-weight:
 
* molecular-weight:
** 174.113
+
** 440.708
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN66-305]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN66-304]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-carbamoyl-l-aspartate}}
+
{{#set: common-name=14-oxolanosterol}}
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=pggimliqohyfis-puxrvuthsa-n}}
{{#set: molecular-weight=174.113}}
+
{{#set: molecular-weight=440.708}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-4573

  • common-name:
    • 14-oxolanosterol
  • smiles:
    • cc(c)=cccc([ch]1(c2(c)(c(c=o)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
  • inchi-key:
    • pggimliqohyfis-puxrvuthsa-n
  • molecular-weight:
    • 440.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality