Difference between revisions of "PWY-5484"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] ==
+== Pathway PWY-5484 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** n-acetyl-&beta;-glucosaminylamine
+** glycolysis ii (from fructose 6-phosphate)
-* smiles:
+== Reaction(s) found ==
-** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
+* [[2PGADEHYDRAT-RXN]]
-* inchi-key:
+* [[3PGAREARR-RXN]]
-** mcgxocxffnkasf-fmdgeedcsa-n
+* [[6PFRUCTPHOS-RXN]]
-* molecular-weight:
+* [[F16ALDOLASE-RXN]]
-** 220.225
+* [[F16BDEPHOS-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[GAPOXNPHOSPHN-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[PEPDEPHOS-RXN]]
-* [[3.5.1.26-RXN]]
+* [[PHOSGLYPHOS-RXN]]
-* [[3.5.1.52-RXN]]
+* [[RXN-15513]]
-== Reaction(s) of unknown directionality ==
+* [[TRIOSEPISOMERIZATION-RXN]]
-{{#set: common-name=n-acetyl-&beta;-glucosaminylamine}}
+== Reaction(s) not found ==
-{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
+* [NonePEPSYNTH-RXN PEPSYNTH-RXN]
-{{#set: molecular-weight=220.225}}
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
+{{#set: common-name=glycolysis ii (from fructose 6-phosphate)}}
+{{#set: nb reaction found=10}}
+{{#set: completion rate=0.91}}
+{{#set: nb total reaction=11}}