Difference between revisions of "PWY-5485"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-valine N-terminal-L-valine] == * common-name: ** an n-terminal l-valyl-[protein] =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-valine N-terminal-L-valine] ==
 
* common-name:
 
* common-name:
** delphinidin 3,5-di-o-β-d-glucoside
+
** an n-terminal l-valyl-[protein]
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
 
* inchi-key:
 
** xctgxgvgjyacei-lcenjuansa-n
 
* molecular-weight:
 
** 626.524
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8228]]
+
* [[RXN-17878]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=an n-terminal l-valyl-[protein]}}
{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
 
{{#set: molecular-weight=626.524}}
 

Revision as of 14:18, 26 August 2019

Metabolite N-terminal-L-valine

  • common-name:
    • an n-terminal l-valyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-valyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.