Difference between revisions of "PWY-5485"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+== Pathway PWY-6693 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** &beta;-d-glucose 6-phosphate
+** d-galactose degradation iv
-* smiles:
+== Reaction(s) found ==
-** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
+* [[RXN-12078]]
-* inchi-key:
+== Reaction(s) not found ==
-** nbschqhzlsjfnq-vfuothlcsa-l
+* [NoneRXN-12080 RXN-12080]
-* molecular-weight:
+* [NoneRXN-12079 RXN-12079]
-** 258.121
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=d-galactose degradation iv}}
-* [[G6PBDH]]
+{{#set: nb reaction found=1}}
-* [[G6PBDHh]]
+{{#set: completion rate=0.33}}
-* [[G6PI]]
+{{#set: nb total reaction=3}}
-* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
-* [[PGIB]]
-* [[PGIBh]]
-* [[RXN66-579]]
-== Reaction(s) known to produce the compound ==
-* [[G6PI]]
-* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
-* [[PGIB]]
-* [[PGIBh]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&beta;-d-glucose 6-phosphate}}
-{{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}}
-{{#set: molecular-weight=258.121}}