Difference between revisions of "PWY-5489"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smil...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * common-name: ** 5-dehydroavenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+
** 5-dehydroavenasterol
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
+
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** bzxzfdkirzbjep-jmtmcxqrsa-m
+
** xprwwanupmykmf-hvegqnehsa-n
 
* molecular-weight:
 
* molecular-weight:
** 293.425
+
** 410.682
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-4210]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[RXN-4209]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+
{{#set: common-name=5-dehydroavenasterol}}
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
+
{{#set: inchi-key=inchikey=xprwwanupmykmf-hvegqnehsa-n}}
{{#set: molecular-weight=293.425}}
+
{{#set: molecular-weight=410.682}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-4126

  • common-name:
    • 5-dehydroavenasterol
  • smiles:
    • cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • xprwwanupmykmf-hvegqnehsa-n
  • molecular-weight:
    • 410.682

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality