Difference between revisions of "PWY-5489"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-KETOACYL-ACP B-KETOACYL-ACP] == * common-name: ** a 3-oxoacyl-[acp] == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** bzxzfdkirzbjep-jmtmcxqrsa-m | ||
| + | * molecular-weight: | ||
| + | ** 293.425 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} |
| + | {{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}} | ||
| + | {{#set: molecular-weight=293.425}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-730
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
- inchi-key:
- bzxzfdkirzbjep-jmtmcxqrsa-m
- molecular-weight:
- 293.425
