Difference between revisions of "PWY-5493"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA3-ISOPENTENYL-PP DELTA3-ISOPENTENYL-PP] ==
+== Pathway PWY-5493 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** isopentenyl diphosphate
+** reductive monocarboxylic acid cycle
-* smiles:
+== Reaction(s) found ==
-** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
+* [[PYRUFLAVREDUCT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** nuhsrofqtuxzqq-uhfffaoysa-k
+* [NonePYRUVFORMLY-RXN PYRUVFORMLY-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 243.069
+{{#set: common-name=reductive monocarboxylic acid cycle}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[FARNESYLTRANSTRANSFERASE-RXN]]
+{{#set: completion rate=0.5}}
-* [[FPPS]]
+{{#set: nb total reaction=2}}
-* [[FPPSYN-RXN]]
-* [[GGPS]]
-* [[GPPS]]
-* [[GPPSYN-RXN]]
-* [[IDI]]
-* [[IPPISOM-RXN]]
-* [[RXN-10068]]
-* [[RXN-11486]]
-* [[RXN-11488]]
-* [[RXN-11963]]
-* [[RXN-8999]]
-* [[RXN-9969]]
-* [[RXN0-5180]]
-* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
-== Reaction(s) known to produce the compound ==
-* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
-* [[GPPSYN-RXN]]
-* [[IDS1]]
-* [[IPPISOM-RXN]]
-* [[ISPH2-RXN]]
-* [[RXN-10068]]
-* [[RXN-11963]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=isopentenyl diphosphate}}
-{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
-{{#set: molecular-weight=243.069}}