Difference between revisions of "PWY-5493"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA3-ISOPENTENYL-PP DELTA3-ISOPENTENYL-PP] == * common-name: ** isopentenyl diphosphate * smi...")
(Created page with "Category:pathway == Pathway PWY-6961 == * taxonomic-range: ** tax-2 * common-name: ** l-ascorbate degradation ii (bacterial, aerobic) == Reaction(s) found == * RXN-12440...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA3-ISOPENTENYL-PP DELTA3-ISOPENTENYL-PP] ==
+
== Pathway PWY-6961 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
−
** isopentenyl diphosphate
+
** l-ascorbate degradation ii (bacterial, aerobic)
−
* smiles:
+
== Reaction(s) found ==
−
** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
+
* [[RXN-12440]]
−
* inchi-key:
+
== Reaction(s) not found ==
−
** nuhsrofqtuxzqq-uhfffaoysa-k
+
* [NoneRXN0-704 RXN0-704]
−
* molecular-weight:
+
* [NoneRXN0-703 RXN0-703]
−
** 243.069
+
* [NoneRXN-12861 RXN-12861]
−
== Reaction(s) known to consume the compound ==
+
* [NoneRXN0-705 RXN0-705]
−
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
* [NoneLXULRU5P-RXN LXULRU5P-RXN]
−
* [[FPPS]]
+
* [NoneRIBULPEPIM-RXN RIBULPEPIM-RXN]
−
* [[FPPSYN-RXN]]
+
* [NoneRXN-12862 RXN-12862]
−
* [[GGPS]]
+
{{#set: taxonomic-range=tax-2}}
−
* [[GPPS]]
+
{{#set: common-name=l-ascorbate degradation ii (bacterial, aerobic)}}
−
* [[GPPSYN-RXN]]
+
{{#set: nb reaction found=1}}
−
* [[IDI]]
+
{{#set: completion rate=0.12}}
−
* [[IPPISOM-RXN]]
+
{{#set: nb total reaction=8}}
−
* [[RXN-10068]]
 
−
* [[RXN-11486]]
 
−
* [[RXN-11488]]
 
−
* [[RXN-11963]]
 
−
* [[RXN-8999]]
 
−
* [[RXN-9969]]
 
−
* [[RXN0-5180]]
 
−
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 
−
* [[GPPSYN-RXN]]
 
−
* [[IDS1]]
 
−
* [[IPPISOM-RXN]]
 
−
* [[ISPH2-RXN]]
 
−
* [[RXN-10068]]
 
−
* [[RXN-11963]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=isopentenyl diphosphate}}
 
−
{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
 
−
{{#set: molecular-weight=243.069}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6961

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-ascorbate degradation ii (bacterial, aerobic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN0-704 RXN0-704]
  • [NoneRXN0-703 RXN0-703]
  • [NoneRXN-12861 RXN-12861]
  • [NoneRXN0-705 RXN0-705]
  • [NoneLXULRU5P-RXN LXULRU5P-RXN]
  • [NoneRIBULPEPIM-RXN RIBULPEPIM-RXN]
  • [NoneRXN-12862 RXN-12862]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-5493&oldid=40187"