Difference between revisions of "PWY-5497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** cis-zeatin-7-n-glucoside
 
* smiles:
 
* smiles:
** coc1(=c(o)c=cc(c(o)c=o)=c1)
+
** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
 
* inchi-key:
 
* inchi-key:
** visajvapypfkcl-qmmmgpobsa-n
+
** htdhrclvwuexis-gihywfgssa-n
 
* molecular-weight:
 
* molecular-weight:
** 182.176
+
** 381.388
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10915]]
 
* [[RXN-10917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10910]]
+
* [[RXN-4733]]
* [[RXN-10913]]
 
* [[RXN-10915]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: common-name=cis-zeatin-7-n-glucoside}}
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
{{#set: molecular-weight=182.176}}
+
{{#set: molecular-weight=381.388}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-4618

  • common-name:
    • cis-zeatin-7-n-glucoside
  • smiles:
    • cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
  • inchi-key:
    • htdhrclvwuexis-gihywfgssa-n
  • molecular-weight:
    • 381.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality