Difference between revisions of "PWY-5497"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
 
* common-name:
 
* common-name:
** cis-zeatin-7-n-glucoside
+
** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
 
* smiles:
 
* smiles:
** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
+
** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
 
* inchi-key:
 
* inchi-key:
** htdhrclvwuexis-gihywfgssa-n
+
** nqeqtypjsiephw-mnovxskesa-l
 
* molecular-weight:
 
* molecular-weight:
** 381.388
+
** 285.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-2381]]
 +
* [[TRYPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4733]]
+
* [[IGPSYN-RXN]]
 +
* [[RXN0-2381]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-zeatin-7-n-glucoside}}
+
{{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
+
{{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}}
{{#set: molecular-weight=381.388}}
+
{{#set: molecular-weight=285.193}}

Revision as of 09:22, 27 August 2019

Metabolite INDOLE-3-GLYCEROL-P

  • common-name:
    • (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
  • inchi-key:
    • nqeqtypjsiephw-mnovxskesa-l
  • molecular-weight:
    • 285.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality