Difference between revisions of "PWY-5514"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] ==
+== Pathway PWY-5514 ==
+* taxonomic-range:
+** tax-68459
 * common-name:
-** 4-hydroxybenzoyl-acetyl-coa
+** udp-n-acetyl-d-galactosamine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[GLUCOKIN-RXN]]
-* inchi-key:
+* [[NAG1P-URIDYLTRANS-RXN]]
-** ovqojjjxnyhopr-fueukbnzsa-j
+* [[PGLUCISOM-RXN]]
-* molecular-weight:
+* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
-** 925.647
+* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[RXN-11246]]
+* [NoneGLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneGLUCOSAMINEPNACETYLTRANS-RXN GLUCOSAMINEPNACETYLTRANS-RXN]
-* [[RXN-11245]]
+{{#set: taxonomic-range=tax-68459}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=udp-n-acetyl-d-galactosamine biosynthesis ii}}
-{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
+{{#set: nb reaction found=5}}
-{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
+{{#set: completion rate=0.71}}
-{{#set: molecular-weight=925.647}}
+{{#set: nb total reaction=7}}