Difference between revisions of "PWY-5514"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * common-name: ** lanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] ==
 
* common-name:
 
* common-name:
** lanosterol
+
** demethylmenaquinol-8
 
* smiles:
 
* smiles:
** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
 
* inchi-key:
 
* inchi-key:
** cahgclmltwqznj-bqniitsrsa-n
+
** fgypgicsxjekcg-aendiincsa-n
 
* molecular-weight:
 
* molecular-weight:
** 426.724
+
** 705.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-130]]
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
* [[RXN66-303]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LANOSTEROL-SYNTHASE-RXN]]
 
* [[RXN-15133]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lanosterol}}
+
{{#set: common-name=demethylmenaquinol-8}}
{{#set: inchi-key=inchikey=cahgclmltwqznj-bqniitsrsa-n}}
+
{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
{{#set: molecular-weight=426.724}}
+
{{#set: molecular-weight=705.118}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-12115

  • common-name:
    • demethylmenaquinol-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
  • inchi-key:
    • fgypgicsxjekcg-aendiincsa-n
  • molecular-weight:
    • 705.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality