Difference between revisions of "PWY-5515"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] ==
+== Pathway PWY-5515 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** (3e)-undec-3-enoyl-coa
+** l-arabinose degradation ii
-* smiles:
+== Reaction(s) found ==
-** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[L-XYLULOSE-REDUCTASE-RXN]]
-* inchi-key:
+* [[RXN-8772]]
-** hvxccjiyxizgop-nadloitosa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneL-ARABINITOL-4-DEHYDROGENASE-RXN L-ARABINITOL-4-DEHYDROGENASE-RXN]
-** 929.765
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-arabinose degradation ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-14776]]
+{{#set: completion rate=0.67}}
-* [[RXN-14790]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(3e)-undec-3-enoyl-coa}}
-{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}
-{{#set: molecular-weight=929.765}}