Difference between revisions of "PWY-5531"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] ==
+== Pathway PWY-5531 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** &gamma;-tocopherol
+** 3,8-divinyl-chlorophyllide a biosynthesis ii (anaerobic)
-* smiles:
+== Reaction(s) found ==
-** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+* [[HEMN-RXN]]
-* inchi-key:
+* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
-** quedxnhftdjviy-dqczwyhmsa-n
+* [[RXN1F-20]]
-* molecular-weight:
+* [[UROGENDECARBOX-RXN]]
-** 416.686
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8799 RXN-8799]
-* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+* [NoneRXN-8797 RXN-8797]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8798 RXN-8798]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN0-6259 RXN0-6259]
-{{#set: common-name=&gamma;-tocopherol}}
+* [NoneRXN-17485 RXN-17485]
-{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: molecular-weight=416.686}}
+{{#set: common-name=3,8-divinyl-chlorophyllide a biosynthesis ii (anaerobic)}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.44}}
+{{#set: nb total reaction=9}}