Difference between revisions of "PWY-5629"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)...")
 
(Created page with "Category:pathway == Pathway PWY-5629 == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** isopenicillin n biosynthesis == Reaction(s) found == * 1.21.3.1-RXN =...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12118 CPD-12118] ==
+
== Pathway PWY-5629 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** demethylmenaquinol-9
+
** isopenicillin n biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
* [[1.21.3.1-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wjuvwmhfghnqjz-rnfptggasa-n
+
* [None6.3.2.26-RXN 6.3.2.26-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-2}}
** 773.236
+
{{#set: common-name=isopenicillin n biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-9205]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=demethylmenaquinol-9}}
 
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
 
{{#set: molecular-weight=773.236}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5629

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • isopenicillin n biosynthesis

Reaction(s) found

Reaction(s) not found

  • [None6.3.2.26-RXN 6.3.2.26-RXN]