Difference between revisions of "PWY-5642"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
+== Pathway PWY-5642 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** o-sinapoylcholine
+** 2,4-dinitrotoluene degradation
-* smiles:
+== Reaction(s) found ==
-** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
+* [[1.2.1.27-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hujxhfrxwwgyqh-uhfffaoysa-o
+* [NoneRXN-8820 RXN-8820]
-* molecular-weight:
+* [NoneRXN-8824 RXN-8824]
-** 310.369
+* [NoneRXN-8822 RXN-8822]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17165 RXN-17165]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8821 RXN-8821]
-* [[2.3.1.91-RXN]]
+* [NoneRXN-8823 RXN-8823]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=o-sinapoylcholine}}
+{{#set: common-name=2,4-dinitrotoluene degradation}}
-{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=310.369}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=7}}