Difference between revisions of "PWY-5647"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SOLANESYL-PYROPHOSPHATE SOLANESYL-PYROPHOSPHATE] == * common-name: ** all-trans-nonaprenyl diph...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SOLANESYL-PYROPHOSPHATE SOLANESYL-PYROPHOSPHATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-nonaprenyl diphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ivlbhbftrnviap-meggaxogsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 788.015 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-2761]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11486]] | ||
+ | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-nonaprenyl diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=788.015}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite SOLANESYL-PYROPHOSPHATE
- common-name:
- all-trans-nonaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ivlbhbftrnviap-meggaxogsa-k
- molecular-weight:
- 788.015