Difference between revisions of "PWY-5647"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SOLANESYL-PYROPHOSPHATE SOLANESYL-PYROPHOSPHATE] ==
+== Pathway GLYCOCAT-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** all-trans-nonaprenyl diphosphate
+** glycogen degradation i
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+* [[GLUCOKIN-RXN]]
-* inchi-key:
+* [[GLYCOPHOSPHORYL-RXN]]
-** ivlbhbftrnviap-meggaxogsa-k
+* [[PHOSPHOGLUCMUT-RXN]]
-* molecular-weight:
+* [[RXN-9025]]
-** 788.015
+* [[RXN0-5182]]
-== Reaction(s) known to consume the compound ==
+* [[RXN0-5183]]
-* [[RXN-2761]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneAMYLOMALT-RXN AMYLOMALT-RXN]
-* [[RXN-11486]]
+* [NoneRXN0-5146 RXN0-5146]
-* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=glycogen degradation i}}
-{{#set: common-name=all-trans-nonaprenyl diphosphate}}
+{{#set: nb reaction found=6}}
-{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
+{{#set: completion rate=0.75}}
-{{#set: molecular-weight=788.015}}
+{{#set: nb total reaction=8}}