Difference between revisions of "PWY-5652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] == * common-name: ** n6,n6,n6-trimethyl-l-...")
 
(Created page with "Category:pathway == Pathway PWY-5652 == * taxonomic-range: ** tax-4751 ** tax-33208 * common-name: ** 2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-coa ==...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] ==
+
== Pathway PWY-5652 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33208
 
* common-name:
 
* common-name:
** n6,n6,n6-trimethyl-l-lysine
+
** 2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-coa
* smiles:
+
== Reaction(s) found ==
** c[n+](ccccc(c([o-])=o)[n+])(c)c
+
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
* inchi-key:
+
* [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]]
** mxnrlfusfkvqsk-qmmmgpobsa-o
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None1.2.1.32-RXN 1.2.1.32-RXN]
** 189.277
+
* [None2-AMINOMUCONATE-REDUCTASE-RXN 2-AMINOMUCONATE-REDUCTASE-RXN]
== Reaction(s) known to consume the compound ==
+
* [None3.5.99.5-RXN 3.5.99.5-RXN]
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+
{{#set: taxonomic-range=tax-4751|tax-33208}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-coa}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=2}}
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: completion rate=0.4}}
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=189.277}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-5652

  • taxonomic-range:
    • tax-4751
    • tax-33208
  • common-name:
    • 2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-coa

Reaction(s) found

Reaction(s) not found

  • [None1.2.1.32-RXN 1.2.1.32-RXN]
  • [None2-AMINOMUCONATE-REDUCTASE-RXN 2-AMINOMUCONATE-REDUCTASE-RXN]
  • [None3.5.99.5-RXN 3.5.99.5-RXN]