Difference between revisions of "PWY-5652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] == * common-name: ** 5-hydroxy-l-tryptophan * smiles...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-TRYPTOPHAN 5-HYDROXY-TRYPTOPHAN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
 
* common-name:
 
* common-name:
** 5-hydroxy-l-tryptophan
+
** β-l-fucose 1-phosphate
 
* smiles:
 
* smiles:
** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
+
** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** ldcyzajdbxycgn-vifpvbqesa-n
+
** ptvxqarclqpgir-sxuwkvjysa-l
 
* molecular-weight:
 
* molecular-weight:
** 220.227
+
** 242.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3DJ-170]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[FUCOKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-l-tryptophan}}
+
{{#set: common-name=β-l-fucose 1-phosphate}}
{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}}
{{#set: molecular-weight=220.227}}
+
{{#set: molecular-weight=242.122}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-488

  • common-name:
    • β-l-fucose 1-phosphate
  • smiles:
    • cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • ptvxqarclqpgir-sxuwkvjysa-l
  • molecular-weight:
    • 242.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality