Difference between revisions of "PWY-5653"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * common-name: ** (2e,7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc=...")
(Created page with "Category:pathway == Pathway PWY-5493 == * taxonomic-range: ** tax-2 * common-name: ** reductive monocarboxylic acid cycle == Reaction(s) found == * PYRUFLAVREDUCT-RXN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Pathway PWY-5493 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** (2e,7z)-tetradecenoyl-coa
+
** reductive monocarboxylic acid cycle
* smiles:
+
== Reaction(s) found ==
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[PYRUFLAVREDUCT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** mwksuvqqmpjtpp-dtpvmwfysa-j
+
* [NonePYRUVFORMLY-RXN PYRUVFORMLY-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 969.83
+
{{#set: common-name=reductive monocarboxylic acid cycle}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17793]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[RXN-17792]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
 
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
 
{{#set: molecular-weight=969.83}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-5493

  • taxonomic-range:
    • tax-2
  • common-name:
    • reductive monocarboxylic acid cycle

Reaction(s) found

Reaction(s) not found

  • [NonePYRUVFORMLY-RXN PYRUVFORMLY-RXN]