Difference between revisions of "PWY-5659"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)c...")
(Created page with "Category:pathway == Pathway PWY-5659 == * taxonomic-range: ** tax-2157 ** tax-2759 ** tax-2 * common-name: ** gdp-mannose biosynthesis == Reaction(s) found == * MANNPISO...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] ==
+
== Pathway PWY-5659 ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** n-acetyl-l-citrulline
+
** gdp-mannose biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc(c([o-])=o)cccnc(=o)n
+
* [[MANNPISOM-RXN]]
* inchi-key:
+
* [[PGLUCISOM-RXN]]
** wmqmioyqxnrroc-lurjtmiesa-m
+
* [[PHOSMANMUT-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 216.216
+
* [None2.7.7.13-RXN 2.7.7.13-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
* [[RXN-7933]]
+
{{#set: common-name=gdp-mannose biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=n-acetyl-l-citrulline}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
 
{{#set: molecular-weight=216.216}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5659

  • taxonomic-range:
    • tax-2157
    • tax-2759
    • tax-2
  • common-name:
    • gdp-mannose biosynthesis

Reaction(s) found

Reaction(s) not found

  • [None2.7.7.13-RXN 2.7.7.13-RXN]