Difference between revisions of "PWY-5659"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * common-name: ** ent-kaurenol * smiles: ** c=c1(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-l-citrulline |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc(c([o-])=o)cccnc(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wmqmioyqxnrroc-lurjtmiesa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 216.216 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7933]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-l-citrulline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=216.216}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-7224
- common-name:
- n-acetyl-l-citrulline
- smiles:
- cc(=o)nc(c([o-])=o)cccnc(=o)n
- inchi-key:
- wmqmioyqxnrroc-lurjtmiesa-m
- molecular-weight:
- 216.216
