Difference between revisions of "PWY-5661"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+== Pathway PWY-5661 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** 3,7-dimethylurate
+** gdp-glucose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
+* [[GLUCOKIN-RXN]]
-* inchi-key:
+* [[PHOSPHOGLUCMUT-RXN]]
-** hmlzlhkhnblljd-uhfffaoysa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [None2.7.7.34-RXN 2.7.7.34-RXN]
-** 196.165
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=gdp-glucose biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-11519]]
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3,7-dimethylurate}}
-{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
-{{#set: molecular-weight=196.165}}