Difference between revisions of "PWY-5661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] ==
 
* common-name:
 
* common-name:
** 3,7-dimethylurate
+
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
 
* smiles:
 
* smiles:
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
+
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** hmlzlhkhnblljd-uhfffaoysa-n
+
** rfenovfrmprrji-ydcwotkksa-l
 
* molecular-weight:
 
* molecular-weight:
** 196.165
+
** 212.159
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MHPCHYDROL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11519]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,7-dimethylurate}}
+
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
{{#set: molecular-weight=196.165}}
+
{{#set: molecular-weight=212.159}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-157

  • common-name:
    • (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
  • smiles:
    • c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • rfenovfrmprrji-ydcwotkksa-l
  • molecular-weight:
    • 212.159

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality