Difference between revisions of "PWY-5661"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] ==
+== Pathway PWY-5661 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
+** gdp-glucose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
+* [[GLUCOKIN-RXN]]
-* inchi-key:
+* [[PHOSPHOGLUCMUT-RXN]]
-** rfenovfrmprrji-ydcwotkksa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [None2.7.7.34-RXN 2.7.7.34-RXN]
-** 212.159
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=gdp-glucose biosynthesis}}
-* [[MHPCHYDROL-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
-{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
-{{#set: molecular-weight=212.159}}