Difference between revisions of "PWY-5664"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-hydroxydihydroceramides Alpha-hydroxydihydroceramides] == * common-name: ** a (2'r)-2'-hy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-hydroxydihydroceramides Alpha-hydroxydihydroceramides] ==
 
* common-name:
 
* common-name:
** 5-(methylthio)ribulose 1-phosphate
+
** a (2'r)-2'-hydroxydihydroceramide
* smiles:
 
** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
 
* inchi-key:
 
** cnsjryumvmwnmc-ritpcoansa-l
 
* molecular-weight:
 
** 258.182
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R145-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.3.1.23-RXN]]
+
* [[RXN-7796]]
* [[M5TRPI]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-(methylthio)ribulose 1-phosphate}}
+
{{#set: common-name=a (2'r)-2'-hydroxydihydroceramide}}
{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
 
{{#set: molecular-weight=258.182}}
 

Revision as of 14:18, 26 August 2019

Metabolite Alpha-hydroxydihydroceramides

  • common-name:
    • a (2'r)-2'-hydroxydihydroceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality