Difference between revisions of "PWY-5670"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] ==
+== Pathway PWY-5670 ==
+* taxonomic-range:
+** tax-2157
+** tax-203682
+** tax-1224
+** tax-2759
 * common-name:
-** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
+** epoxysqualene biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
+* [[RXN-13162]]
-* inchi-key:
+* [[SQUALENE-MONOOXYGENASE-RXN]]
-** yszsvgfmajxgmq-fricuitqsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN66-281 RXN66-281]
-** 575.85
+* [NoneRXN-12263 RXN-12263]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-203682|tax-1224|tax-2157|tax-2759}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=epoxysqualene biosynthesis}}
-* [[2.1.1.114-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.67}}
-{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
+{{#set: nb total reaction=3}}
-{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
-{{#set: molecular-weight=575.85}}