Difference between revisions of "PWY-5670"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] == * common-...")
(Created page with "Category:pathway == Pathway PWY-7726 == * taxonomic-range: ** tax-2759 * common-name: ** (4z,7z,10z,13z,16z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase) ==...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] ==
+
== Pathway PWY-7726 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
+
** (4z,7z,10z,13z,16z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
* smiles:
+
== Reaction(s) found ==
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
+
* [[RXN-16112]]
* inchi-key:
+
* [[RXN-16113]]
** yszsvgfmajxgmq-fricuitqsa-m
+
* [[RXN-17109]]
* molecular-weight:
+
* [[RXN-17110]]
** 575.85
+
* [[RXN-17112]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-17113]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-17114]]
* [[2.1.1.114-RXN]]
+
* [[RXN-17116]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
+
* [NoneRXN-17111 RXN-17111]
{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
+
* [NoneRXN-17115 RXN-17115]
{{#set: molecular-weight=575.85}}
+
* [NoneRXN-16079 RXN-16079]
 +
* [NoneRXN-16114 RXN-16114]
 +
* [NoneRXN-16081 RXN-16081]
 +
{{#set: taxonomic-range=tax-2759}}
 +
{{#set: common-name=(4z,7z,10z,13z,16z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)}}
 +
{{#set: nb reaction found=8}}
 +
{{#set: completion rate=0.62}}
 +
{{#set: nb total reaction=13}}

Revision as of 20:16, 18 December 2020

Pathway PWY-7726

  • taxonomic-range:
    • tax-2759
  • common-name:
    • (4z,7z,10z,13z,16z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17111 RXN-17111]
  • [NoneRXN-17115 RXN-17115]
  • [NoneRXN-16079 RXN-16079]
  • [NoneRXN-16114 RXN-16114]
  • [NoneRXN-16081 RXN-16081]