Difference between revisions of "PWY-5675"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9100 CPD-9100] == * common-name: ** tetrahydrogeranylgeranyl bacteriopheophytin * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * common-name: ** 5α-cholestan-3-one * smiles: ** cc(c)cccc(c)[ch]3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9100 CPD-9100] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl bacteriopheophytin
+
** 5α-cholestan-3-one
 
* smiles:
 
* smiles:
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** zodfiocmoawrmb-zasykxldsa-n
+
** peskgjqreuxsrr-uxiwksivsa-n
 
* molecular-weight:
 
* molecular-weight:
** 886.205
+
** 386.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8796]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8795]]
+
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=5α-cholestan-3-one}}
{{#set: inchi-key=inchikey=zodfiocmoawrmb-zasykxldsa-n}}
+
{{#set: inchi-key=inchikey=peskgjqreuxsrr-uxiwksivsa-n}}
{{#set: molecular-weight=886.205}}
+
{{#set: molecular-weight=386.66}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-1081

  • common-name:
    • 5α-cholestan-3-one
  • smiles:
    • cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • peskgjqreuxsrr-uxiwksivsa-n
  • molecular-weight:
    • 386.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality