Difference between revisions of "PWY-5675"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] == * common-name: ** 2-deoxy-d-glu...")
(Created page with "Category:pathway == Pathway PWY-5675 == * taxonomic-range: ** tax-2 ** tax-4751 * common-name: ** nitrate reduction v (assimilatory) == Reaction(s) found == * GLUTAMINES...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] ==
+
== Pathway PWY-5675 ==
 +
* taxonomic-range:
 +
** tax-2
 +
** tax-4751
 
* common-name:
 
* common-name:
** 2-deoxy-d-glucose 6-phosphate
+
** nitrate reduction v (assimilatory)
* smiles:
+
== Reaction(s) found ==
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
+
* [[GLUTAMINESYN-RXN]]
* inchi-key:
+
* [[GLUTDEHYD-RXN]]
** uqjfzaagzayvkz-cermhhmhsa-l
+
* [[NITRATE-REDUCTASE-NADPH-RXN]]
* molecular-weight:
+
* [[RXN0-6377]]
** 242.122
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
All reactions of this pathways are in present
* [[3.1.3.68-RXN]]
+
{{#set: taxonomic-range=tax-2|tax-4751}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=nitrate reduction v (assimilatory)}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=4}}
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
+
{{#set: completion rate=1.0}}
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
+
{{#set: nb total reaction=4}}
{{#set: molecular-weight=242.122}}
 

Revision as of 20:15, 18 December 2020

Pathway PWY-5675

  • taxonomic-range:
    • tax-2
    • tax-4751
  • common-name:
    • nitrate reduction v (assimilatory)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present