Difference between revisions of "PWY-5677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] == * common-name: ** d-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
 
* common-name:
 
* common-name:
** d-xylulose
+
** 3-oxo-(11z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(=o)co
+
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** zaqjhhrnxzubte-wujlrwpwsa-n
+
** ourowzutgfhrje-saiinbspsa-j
 
* molecular-weight:
 
* molecular-weight:
** 150.131
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[XYLULOKIN-RXN]]
+
* [[RXN-17787]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17786]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-xylulose}}
+
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=zaqjhhrnxzubte-wujlrwpwsa-n}}
+
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
{{#set: molecular-weight=150.131}}
+
{{#set: molecular-weight=1041.936}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-19160

  • common-name:
    • 3-oxo-(11z)-octadecenoyl-coa
  • smiles:
    • ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ourowzutgfhrje-saiinbspsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality