Difference between revisions of "PWY-5677"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] == * common-name: ** d-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-(11z)-octadecenoyl-coa |
* smiles: | * smiles: | ||
− | ** c(o)c(o)c(o)c(=o) | + | ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ourowzutgfhrje-saiinbspsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1041.936 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17787]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17786]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1041.936}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-19160
- common-name:
- 3-oxo-(11z)-octadecenoyl-coa
- smiles:
- ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ourowzutgfhrje-saiinbspsa-j
- molecular-weight:
- 1041.936