Difference between revisions of "PWY-5695"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13025 CPD-13025] == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15163 CPD-15163] == * common-name: ** prop-2-ynal * smiles: ** c#cc=o * inchi-key: ** ijnjl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13025 CPD-13025] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15163 CPD-15163] ==
 
* common-name:
 
* common-name:
** guanosine 2'-monophosphate
+
** prop-2-ynal
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c#cc=o
 
* inchi-key:
 
* inchi-key:
** wtifiazwccbcge-uuokfmhzsa-l
+
** ijnjlgftsiahea-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 361.207
+
** 54.048
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14224]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12058]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2'-monophosphate}}
+
{{#set: common-name=prop-2-ynal}}
{{#set: inchi-key=inchikey=wtifiazwccbcge-uuokfmhzsa-l}}
+
{{#set: inchi-key=inchikey=ijnjlgftsiahea-uhfffaoysa-n}}
{{#set: molecular-weight=361.207}}
+
{{#set: molecular-weight=54.048}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-15163

  • common-name:
    • prop-2-ynal
  • smiles:
    • c#cc=o
  • inchi-key:
    • ijnjlgftsiahea-uhfffaoysa-n
  • molecular-weight:
    • 54.048

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality