Difference between revisions of "PWY-5710"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-DIPHOSPHO-1D-MYO-INOSITOL-12346P 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P] ==
+== Pathway PWY-5710 ==
+* taxonomic-range:
+** tax-4070
 * common-name:
-** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+** capsaicin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** uphpwxpnziozjl-kxxvrosksa-a
+* [NoneRXN-8925 RXN-8925]
-* molecular-weight:
+* [None4.1.2.41-RXN 4.1.2.41-RXN]
-** 726.913
+* [NoneRXN-21443 RXN-21443]
-== Reaction(s) known to consume the compound ==
+* [None4.2.1.101-RXN 4.2.1.101-RXN]
-* [[2.7.4.24-RXN]]
+* [NoneRXN-8926 RXN-8926]
-* [[RXN-10964]]
+* [NoneRXN-8927 RXN-8927]
-* [[RXN-10965]]
+{{#set: taxonomic-range=tax-4070}}
-* [[RXN-10979]]
+{{#set: common-name=capsaicin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[2.7.1.152-RXN]]
+{{#set: completion rate=0.14}}
-* [[RXN-10965]]
+{{#set: nb total reaction=7}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
-{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
-{{#set: molecular-weight=726.913}}