Difference between revisions of "PWY-5723"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylsphingosine N-Acylsphingosine] == * common-name: ** a sphingosine ceramide == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylsphingosine N-Acylsphingosine] ==
 
* common-name:
 
* common-name:
** 4-(2-aminophenyl)-2,4-dioxobutanoate
+
** a sphingosine ceramide
* smiles:
 
** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
 
* inchi-key:
 
** caovwyzqmpnafj-uhfffaoysa-m
 
* molecular-weight:
 
** 206.177
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.7-RXN]]
+
* [[RXN-15211]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.7-RXN]]
+
* [[GLUCOSYLCERAMIDASE-RXN]]
 +
* [[RXN-15212]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=a sphingosine ceramide}}
{{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}}
 
{{#set: molecular-weight=206.177}}
 

Revision as of 09:22, 27 August 2019

Metabolite N-Acylsphingosine

  • common-name:
    • a sphingosine ceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality