Difference between revisions of "PWY-5739"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] ==
+== Pathway PWY-5739 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 4-(2-aminophenyl)-2,4-dioxobutanoate
+** gdp-d-perosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
+* [[GDPMANDEHYDRA-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** caovwyzqmpnafj-uhfffaoysa-m
+* [NoneRXN-8953 RXN-8953]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 206.177
+{{#set: common-name=gdp-d-perosamine biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[2.6.1.7-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[2.6.1.7-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
-{{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}}
-{{#set: molecular-weight=206.177}}