Difference between revisions of "PWY-5740"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+== Pathway PWY-5740 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** 3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide
+** gdp-l-colitose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+* [[GDPMANDEHYDRA-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** yyfgggcinngole-zdxogfqlsa-m
+* [NoneRXN-15218 RXN-15218]
-* molecular-weight:
+* [NoneRXN-15217 RXN-15217]
-** 826.095
+* [NoneRXN-8955 RXN-8955]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8954 RXN-8954]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1224}}
-* [[RXN-10607]]
+{{#set: common-name=gdp-l-colitose biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=826.095}}