Difference between revisions of "PWY-5740"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+== Pathway PWY-6664 ==
+* taxonomic-range:
+** tax-2
+** tax-2157
 * common-name:
-** 3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide
+** di-myo-inositol phosphate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** yyfgggcinngole-zdxogfqlsa-m
+* [NoneRXN-11877 RXN-11877]
-* molecular-weight:
+* [NoneRXN-11879 RXN-11879]
-** 826.095
+* [NoneRXN-11880 RXN-11880]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=di-myo-inositol phosphate biosynthesis}}
-* [[RXN-10607]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic &beta;-d-glucuronide}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
-{{#set: molecular-weight=826.095}}