Difference between revisions of "PWY-5750"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2352 CPD0-2352] == * common-name: ** a trna precursor with a 5' extension and a short 3' e...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * common-name: ** 1-18:1-2-lysophosphatidylethanolamine * smiles: ** cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:1-2-lysophosphatidylethanolamine |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o | ||
| + | * inchi-key: | ||
| + | ** pyvrvrfvlrnjly-mzmpxxgtsa-n | ||
| + | * molecular-weight: | ||
| + | ** 479.593 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15035]] |
| + | * [[RXN-15036]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15036]] |
| + | * [[RXN-15067]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:1-2-lysophosphatidylethanolamine}} |
| + | {{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}} | ||
| + | {{#set: molecular-weight=479.593}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-8355
- common-name:
- 1-18:1-2-lysophosphatidylethanolamine
- smiles:
- ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
- inchi-key:
- pyvrvrfvlrnjly-mzmpxxgtsa-n
- molecular-weight:
- 479.593
