Difference between revisions of "PWY-5754"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ETHYLMALEIMIDE N-ETHYLMALEIMIDE] == * common-name: ** n-ethylmaleimide * smiles: ** ccn1(c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ETHYLMALEIMIDE N-ETHYLMALEIMIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOPENTAOSE MALTOPENTAOSE] ==
 
* common-name:
 
* common-name:
** n-ethylmaleimide
+
** maltopentaose
 
* smiles:
 
* smiles:
** ccn1(c(=o)c=cc(=o)1)
+
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
* inchi-key:
 
* inchi-key:
** hdfgopsgaurceo-uhfffaoysa-n
+
** ftnipwxxignqqf-hzwihctqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 125.127
+
** 828.725
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5101]]
+
* [[RXN-14281]]
 +
* [[RXN-14284]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14282]]
 +
* [[RXN-14285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-ethylmaleimide}}
+
{{#set: common-name=maltopentaose}}
{{#set: inchi-key=inchikey=hdfgopsgaurceo-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
{{#set: molecular-weight=125.127}}
+
{{#set: molecular-weight=828.725}}

Revision as of 09:22, 27 August 2019

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • molecular-weight:
    • 828.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality