Difference between revisions of "PWY-5789"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == * common-name: ** 2-formylaminobenzaldehyde * smiles: ** c(c1(c(=cc=cc=1)nc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** xanthosine |
* smiles: | * smiles: | ||
| − | ** c(c1(c(= | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ubortcndukbeop-uuokfmhzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 284.228 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-363]] | ||
| + | * [[XANTHOSINEPHOSPHORY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[X5NT]] |
| + | * [[XMPXAN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xanthosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=284.228}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite XANTHOSINE
- common-name:
- xanthosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- ubortcndukbeop-uuokfmhzsa-n
- molecular-weight:
- 284.228
