Difference between revisions of "PWY-5789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc...")
(Created page with "Category:pathway == Pathway PWY-5789 == * taxonomic-range: ** tax-28889 * common-name: ** 3-hydroxypropanoate/4-hydroxybutanate cycle == Reaction(s) found == * ACETYL-CO...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] ==
+
== Pathway PWY-5789 ==
 +
* taxonomic-range:
 +
** tax-28889
 
* common-name:
 
* common-name:
** xanthosine
+
** 3-hydroxypropanoate/4-hydroxybutanate cycle
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
* inchi-key:
+
* [[BIOTIN-CARBOXYL-RXN]]
** ubortcndukbeop-uuokfmhzsa-n
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
* molecular-weight:
+
* [[RXN-11662]]
** 284.228
+
* [[RXN-11667]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-6383]]
* [[RXN0-363]]
+
* [[RXN0-5055]]
* [[XANTHOSINEPHOSPHORY-RXN]]
+
* [[RXN0-5224]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
* [[X5NT]]
+
* [NoneRXN-8963 RXN-8963]
* [[XMPXAN-RXN]]
+
* [NoneRXN-8891 RXN-8891]
== Reaction(s) of unknown directionality ==
+
* [NoneMETHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
{{#set: common-name=xanthosine}}
+
* [NoneRXN-8974 RXN-8974]
{{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}}
+
* [NoneRXN-9086 RXN-9086]
{{#set: molecular-weight=284.228}}
+
* [NoneRXN-8890 RXN-8890]
 +
* [NoneRXN-9087 RXN-9087]
 +
* [NoneMETHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN]
 +
* [NoneRXN-9092 RXN-9092]
 +
* [NoneRXN-11002 RXN-11002]
 +
{{#set: taxonomic-range=tax-28889}}
 +
{{#set: common-name=3-hydroxypropanoate/4-hydroxybutanate cycle}}
 +
{{#set: nb reaction found=8}}
 +
{{#set: completion rate=0.44}}
 +
{{#set: nb total reaction=18}}

Revision as of 20:15, 18 December 2020

Pathway PWY-5789

  • taxonomic-range:
    • tax-28889
  • common-name:
    • 3-hydroxypropanoate/4-hydroxybutanate cycle

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8963 RXN-8963]
  • [NoneRXN-8891 RXN-8891]
  • [NoneMETHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
  • [NoneRXN-8974 RXN-8974]
  • [NoneRXN-9086 RXN-9086]
  • [NoneRXN-8890 RXN-8890]
  • [NoneRXN-9087 RXN-9087]
  • [NoneMETHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN]
  • [NoneRXN-9092 RXN-9092]
  • [NoneRXN-11002 RXN-11002]