Difference between revisions of "PWY-5800"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] ==
+== Pathway PWY-5800 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** fmn
+** xylan biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
+* [[RXN-9104]]
-* inchi-key:
+== Reaction(s) not found ==
-** ankzybdxhmzbdk-scrdcrapsa-k
+* [NoneRXN-9093 RXN-9093]
-* molecular-weight:
+* [NoneRXN-9094 RXN-9094]
-** 453.324
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=xylan biosynthesis}}
-* [[FAD-PYROPHOSPHATASE-RXN]]
+{{#set: nb reaction found=1}}
-* [[FADSYN-RXN]]
+{{#set: completion rate=0.33}}
-* [[RXN-9510]]
+{{#set: nb total reaction=3}}
-* [[RXN0-5187]]
-== Reaction(s) known to produce the compound ==
-* [[ARPT]]
-* [[FAD-PYROPHOSPHATASE-RXN]]
-* [[RIBOFLAVINKIN-RXN]]
-* [[RXN-9510]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=fmn}}
-{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
-{{#set: molecular-weight=453.324}}